C30H34N4O3S — CID 118249929
N'-hydroxy-4-[5-[4-[5-methyl-2-(2-phenylethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 118249929) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[5-methyl-2-(2-phenylethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[5-methyl-2-(2-phenylethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 118249929 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[5-methyl-2-(2-phenylethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | Cc1sc(NCCc2ccccc2)nc1-c1ccc(OCCCCCOc2ccc(/C(N)=N/O)cc2)cc1 |
| InChI | InChI=1S/C30H34N4O3S/c1-22-28(33-30(38-22)32-19-18-23-8-4-2-5-9-23)24-10-14-26(15-11-24)36-20-6-3-7-21-37-27-16-12-25(13-17-27)29(31)34-35/h2,4-5,8-17,35H,3,6-7,18-21H2,1H3,(H2,31,34)(H,32,33) |
| InChIKey | RPFSTVWFCLMCIR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|