C27H34N4O3S — CID 91047371
4-[5-[4-[2-amino-5-(cyclopentylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 91047371) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is 4-[5-[4-[2-amino-5-(cyclopentylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[2-amino-5-(cyclopentylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 91047371 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 4-[5-[4-[2-amino-5-(cyclopentylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCCCCCOc2ccc(-c3nc(N)sc3CC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H34N4O3S/c28-26(31-32)21-10-14-23(15-11-21)34-17-5-1-4-16-33-22-12-8-20(9-13-22)25-24(35-27(29)30-25)18-19-6-2-3-7-19/h8-15,19,32H,1-7,16-18H2,(H2,28,31)(H2,29,30) |
| InChIKey | FTXJIKJVUFADNI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|