C30H38N6O3S — CID 149151773
N'-hydroxy-4-[5-[4-[5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 149151773) has the molecular formula C30H38N6O3S and a molecular weight of 562.74 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 149151773 |
| Molecular Formula | C30H38N6O3S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[5-[2-(3-imidazol-1-ylpropylamino)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | Cc1nc(-c2ccc(OCCCCCOc3ccc(C(N)=NO)cc3)cc2)c(CCNCCCn2ccnc2)s1 |
| InChI | InChI=1S/C30H38N6O3S/c1-23-34-29(28(40-23)14-16-32-15-5-18-36-19-17-33-22-36)24-6-10-26(11-7-24)38-20-3-2-4-21-39-27-12-8-25(9-13-27)30(31)35-37/h6-13,17,19,22,32,37H,2-5,14-16,18,20-21H2,1H3,(H2,31,35) |
| InChIKey | QDJVNNDJBQYGJO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|