C25H32N4O2S — CID 90825786
N'-hydroxy-3-[[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]-pentylamino]benzenecarboximidamide (PubChem CID 90825786) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is N'-hydroxy-3-[[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]-pentylamino]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]-pentylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 90825786 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N'-hydroxy-3-[[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]-pentylamino]benzenecarboximidamide |
| SMILES | CCCCCN(Oc1ccc(-c2nc(C)sc2C(C)C)cc1)c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C25H32N4O2S/c1-5-6-7-15-29(21-10-8-9-20(16-21)25(26)28-30)31-22-13-11-19(12-14-22)23-24(17(2)3)32-18(4)27-23/h8-14,16-17,30H,5-7,15H2,1-4H3,(H2,26,28) |
| InChIKey | ZFJQTRVDODWXHN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|