C24H29NO2S — CID 91079540
2-methyl-4-[4-(5-phenoxypentoxy)phenyl]-5-propan-2-yl-1,3-thiazole (PubChem CID 91079540) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is 2-methyl-4-[4-(5-phenoxypentoxy)phenyl]-5-propan-2-yl-1,3-thiazole.
| Compound Name | 2-methyl-4-[4-(5-phenoxypentoxy)phenyl]-5-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 91079540 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-methyl-4-[4-(5-phenoxypentoxy)phenyl]-5-propan-2-yl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(OCCCCCOc3ccccc3)cc2)c(C(C)C)s1 |
| InChI | InChI=1S/C24H29NO2S/c1-18(2)24-23(25-19(3)28-24)20-12-14-22(15-13-20)27-17-9-5-8-16-26-21-10-6-4-7-11-21/h4,6-7,10-15,18H,5,8-9,16-17H2,1-3H3 |
| InChIKey | XDFACLWPICKQHL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|