C28H36N4O4S — CID 24760798
N-[2-[4-[4-[5-[2-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethyl]-2-methylpropanamide (PubChem CID 24760798) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[2-[4-[4-[5-[2-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[4-[4-[5-[2-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 24760798 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | N-[2-[4-[4-[5-[2-[(Z)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-methyl-1,3-thiazol-5-yl]ethyl]-2-methylpropanamide |
| SMILES | Cc1nc(-c2ccc(OCCCCCOc3ccccc3/C(N)=N/O)cc2)c(CCNC(=O)C(C)C)s1 |
| InChI | InChI=1S/C28H36N4O4S/c1-19(2)28(33)30-16-15-25-26(31-20(3)37-25)21-11-13-22(14-12-21)35-17-7-4-8-18-36-24-10-6-5-9-23(24)27(29)32-34/h5-6,9-14,19,34H,4,7-8,15-18H2,1-3H3,(H2,29,32)(H,30,33) |
| InChIKey | FFYYPPZTWPDXJO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|