C27H36N4O2S — CID 172787855
2-[5-[4-[5-butyl-2-(ethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 172787855) has the molecular formula C27H36N4O2S and a molecular weight of 480.68 g/mol. Its IUPAC name is 2-[5-[4-[5-butyl-2-(ethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | 2-[5-[4-[5-butyl-2-(ethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 172787855 |
| Molecular Formula | C27H36N4O2S |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[5-[4-[5-butyl-2-(ethylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1OCCCCCOc1ccc(-c2nc(NCC)sc2CCCC)cc1 |
| InChI | InChI=1S/C27H36N4O2S/c1-3-5-13-24-25(31-27(34-24)30-4-2)20-14-16-21(17-15-20)32-18-9-6-10-19-33-23-12-8-7-11-22(23)26(28)29/h7-8,11-12,14-17H,3-6,9-10,13,18-19H2,1-2H3,(H3,28,29)(H,30,31) |
| InChIKey | PDLWRIKNQPTYOB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|