C35H41N5O4S — CID 46852920
N-cyclopropyl-N-[2-[4-[4-[5-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-propan-2-yl-1,3-thiazol-5-yl]ethyl]pyridine-4-carboxamide (PubChem CID 46852920) has the molecular formula C35H41N5O4S and a molecular weight of 627.81 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[4-[4-[5-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-propan-2-yl-1,3-thiazol-5-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-cyclopropyl-N-[2-[4-[4-[5-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-propan-2-yl-1,3-thiazol-5-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 46852920 |
| Molecular Formula | C35H41N5O4S |
| Molecular Weight | 627.81 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | N-cyclopropyl-N-[2-[4-[4-[5-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]pentoxy]phenyl]-2-propan-2-yl-1,3-thiazol-5-yl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)c1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N\O)cc3)cc2)c(CCN(C(=O)c2ccncc2)C2CC2)s1 |
| InChI | InChI=1S/C35H41N5O4S/c1-24(2)34-38-32(31(45-34)18-21-40(28-10-11-28)35(41)27-16-19-37-20-17-27)25-6-12-29(13-7-25)43-22-4-3-5-23-44-30-14-8-26(9-15-30)33(36)39-42/h6-9,12-17,19-20,24,28,42H,3-5,10-11,18,21-23H2,1-2H3,(H2,36,39) |
| InChIKey | UTIZXAPWXLIHFG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|