C24H22F5N5O4S — CID 70657296
5-amino-2-fluoro-N-[2-fluoro-5-[1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]benzenesulfonamide (PubChem CID 70657296) has the molecular formula C24H22F5N5O4S and a molecular weight of 571.53 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-[2-fluoro-5-[1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 5-amino-2-fluoro-N-[2-fluoro-5-[1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70657296 |
| Molecular Formula | C24H22F5N5O4S |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 5-amino-2-fluoro-N-[2-fluoro-5-[1-hydroxy-2-[2-[[3-(trifluoromethyl)-2H-indazol-6-yl]oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
| SMILES | Nc1ccc(F)c(S(=O)(=O)Nc2cc(C(O)CNCCOc3ccc4c(C(F)(F)F)[nH]nc4c3)ccc2F)c1 |
| InChI | InChI=1S/C24H22F5N5O4S/c25-17-5-1-13(9-20(17)34-39(36,37)22-10-14(30)2-6-18(22)26)21(35)12-31-7-8-38-15-3-4-16-19(11-15)32-33-23(16)24(27,28)29/h1-6,9-11,21,31,34-35H,7-8,12,30H2,(H,32,33) |
| InChIKey | ITBIVOLVAYDIMJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|