C26H31N5O4S — CID 51347731
3-amino-N-[3-[(1R)-1-hydroxy-2-[2-[(3-propan-2-yl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide (PubChem CID 51347731) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is 3-amino-N-[3-[(1R)-1-hydroxy-2-[2-[(3-propan-2-yl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 3-amino-N-[3-[(1R)-1-hydroxy-2-[2-[(3-propan-2-yl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51347731 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-amino-N-[3-[(1R)-1-hydroxy-2-[2-[(3-propan-2-yl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)c1[nH]nc2cc(OCCNC[C@H](O)c3cccc(NS(=O)(=O)c4cccc(N)c4)c3)ccc12 |
| InChI | InChI=1S/C26H31N5O4S/c1-17(2)26-23-10-9-21(15-24(23)29-30-26)35-12-11-28-16-25(32)18-5-3-7-20(13-18)31-36(33,34)22-8-4-6-19(27)14-22/h3-10,13-15,17,25,28,31-32H,11-12,16,27H2,1-2H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | NBUGIDDRMBKQTJ-VWLOTQADSA-N |
| XLogP | 3.77 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|