C23H26N4O4S2 — CID 70656983
N-[3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]thiophene-2-sulfonamide (PubChem CID 70656983) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 70656983 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-[3-[(1R)-2-[2-[(3-ethyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CCc1[nH]nc2cc(OCCNC[C@H](O)c3cccc(NS(=O)(=O)c4cccs4)c3)ccc12 |
| InChI | InChI=1S/C23H26N4O4S2/c1-2-20-19-9-8-18(14-21(19)26-25-20)31-11-10-24-15-22(28)16-5-3-6-17(13-16)27-33(29,30)23-7-4-12-32-23/h3-9,12-14,22,24,27-28H,2,10-11,15H2,1H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | ZGVSQKRHWQJLSO-QFIPXVFZSA-N |
| XLogP | 3.69 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|