C25H32N4O4S — CID 75628389
N-[3-[2-[2-[(3-cyclobutyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclobutanesulfonamide (PubChem CID 75628389) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[3-[2-[2-[(3-cyclobutyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclobutanesulfonamide.
| Compound Name | N-[3-[2-[2-[(3-cyclobutyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclobutanesulfonamide |
|---|---|
| PubChem CID | 75628389 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[3-[2-[2-[(3-cyclobutyl-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclobutanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C(O)CNCCOc2ccc3c(C4CCC4)[nH]nc3c2)c1)C1CCC1 |
| InChI | InChI=1S/C25H32N4O4S/c30-24(18-6-2-7-19(14-18)29-34(31,32)21-8-3-9-21)16-26-12-13-33-20-10-11-22-23(15-20)27-28-25(22)17-4-1-5-17/h2,6-7,10-11,14-15,17,21,24,26,29-30H,1,3-5,8-9,12-13,16H2,(H,27,28) |
| InChIKey | FMLBKCRUESRIQJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|