C24H23F3N4O4S — CID 70656863
2,4,5-trifluoro-N-[3-[1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide (PubChem CID 70656863) has the molecular formula C24H23F3N4O4S and a molecular weight of 520.53 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[3-[1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trifluoro-N-[3-[1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70656863 |
| Molecular Formula | C24H23F3N4O4S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2,4,5-trifluoro-N-[3-[1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
| SMILES | Cc1[nH]nc2cc(OCCNCC(O)c3cccc(NS(=O)(=O)c4cc(F)c(F)cc4F)c3)ccc12 |
| InChI | InChI=1S/C24H23F3N4O4S/c1-14-18-6-5-17(10-22(18)30-29-14)35-8-7-28-13-23(32)15-3-2-4-16(9-15)31-36(33,34)24-12-20(26)19(25)11-21(24)27/h2-6,9-12,23,28,31-32H,7-8,13H2,1H3,(H,29,30) |
| InChIKey | GLFHAJRTHDDZMX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|