C24H24F2N4O4S — CID 51348037
2,5-difluoro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide (PubChem CID 51348037) has the molecular formula C24H24F2N4O4S and a molecular weight of 502.54 g/mol. Its IUPAC name is 2,5-difluoro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51348037 |
| Molecular Formula | C24H24F2N4O4S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2,5-difluoro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methyl-2H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
| SMILES | Cc1[nH]nc2cc(OCCNC[C@H](O)c3cccc(NS(=O)(=O)c4cc(F)ccc4F)c3)ccc12 |
| InChI | InChI=1S/C24H24F2N4O4S/c1-15-20-7-6-19(13-22(20)29-28-15)34-10-9-27-14-23(31)16-3-2-4-18(11-16)30-35(32,33)24-12-17(25)5-8-21(24)26/h2-8,11-13,23,27,30-31H,9-10,14H2,1H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | XMSXFSKVQRMVMX-QHCPKHFHSA-N |
| XLogP | 3.65 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|