C20H23ClN4O4S — CID 51347729
N-[3-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclopropanesulfonamide (PubChem CID 51347729) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-[3-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclopropanesulfonamide.
| Compound Name | N-[3-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 51347729 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[3-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc([C@@H](O)CNCCOc2ccc3c(Cl)[nH]nc3c2)c1)C1CC1 |
| InChI | InChI=1S/C20H23ClN4O4S/c21-20-17-7-4-15(11-18(17)23-24-20)29-9-8-22-12-19(26)13-2-1-3-14(10-13)25-30(27,28)16-5-6-16/h1-4,7,10-11,16,19,22,25-26H,5-6,8-9,12H2,(H,23,24)/t19-/m0/s1 |
| InChIKey | UNJSGCDVKOIKSB-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|