C23H22Cl2N4O4S — CID 59370727
N-[2-chloro-5-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]benzenesulfonamide (PubChem CID 59370727) has the molecular formula C23H22Cl2N4O4S and a molecular weight of 521.43 g/mol. Its IUPAC name is N-[2-chloro-5-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]benzenesulfonamide.
| Compound Name | N-[2-chloro-5-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59370727 |
| Molecular Formula | C23H22Cl2N4O4S |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | N-[2-chloro-5-[(1R)-2-[2-[(3-chloro-2H-indazol-6-yl)oxy]ethylamino]-1-hydroxyethyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc([C@@H](O)CNCCOc2ccc3c(Cl)[nH]nc3c2)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl2N4O4S/c24-19-9-6-15(12-21(19)29-34(31,32)17-4-2-1-3-5-17)22(30)14-26-10-11-33-16-7-8-18-20(13-16)27-28-23(18)25/h1-9,12-13,22,26,29-30H,10-11,14H2,(H,27,28)/t22-/m0/s1 |
| InChIKey | SJVFJUZUQDZMKW-QFIPXVFZSA-N |
| XLogP | 4.37 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|