C24H25ClN4O5S — CID 51347133
3-chloro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide (PubChem CID 51347133) has the molecular formula C24H25ClN4O5S and a molecular weight of 517.01 g/mol. Its IUPAC name is 3-chloro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51347133 |
| Molecular Formula | C24H25ClN4O5S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-chloro-N-[3-[(1R)-1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]benzenesulfonamide |
| SMILES | COc1n[nH]c2cc(OCCNC[C@H](O)c3cccc(NS(=O)(=O)c4cccc(Cl)c4)c3)ccc12 |
| InChI | InChI=1S/C24H25ClN4O5S/c1-33-24-21-9-8-19(14-22(21)27-28-24)34-11-10-26-15-23(30)16-4-2-6-18(12-16)29-35(31,32)20-7-3-5-17(25)13-20/h2-9,12-14,23,26,29-30H,10-11,15H2,1H3,(H,27,28)/t23-/m0/s1 |
| InChIKey | OBZVUTMHDVOAJB-QHCPKHFHSA-N |
| XLogP | 3.73 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|