C21H26F2N4O5S — CID 59370779
N-[3-[(1R)-2-[2-[[3-(difluoromethoxy)-1H-indazol-6-yl]oxy]ethylamino]-1-hydroxyethyl]phenyl]propane-2-sulfonamide (PubChem CID 59370779) has the molecular formula C21H26F2N4O5S and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[3-[(1R)-2-[2-[[3-(difluoromethoxy)-1H-indazol-6-yl]oxy]ethylamino]-1-hydroxyethyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-[(1R)-2-[2-[[3-(difluoromethoxy)-1H-indazol-6-yl]oxy]ethylamino]-1-hydroxyethyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59370779 |
| Molecular Formula | C21H26F2N4O5S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[3-[(1R)-2-[2-[[3-(difluoromethoxy)-1H-indazol-6-yl]oxy]ethylamino]-1-hydroxyethyl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cccc([C@@H](O)CNCCOc2ccc3c(OC(F)F)n[nH]c3c2)c1 |
| InChI | InChI=1S/C21H26F2N4O5S/c1-13(2)33(29,30)27-15-5-3-4-14(10-15)19(28)12-24-8-9-31-16-6-7-17-18(11-16)25-26-20(17)32-21(22)23/h3-7,10-11,13,19,21,24,27-28H,8-9,12H2,1-2H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | GEBQMNSBHAYSJL-IBGZPJMESA-N |
| XLogP | 3.02 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|