C25H28N4O6S — CID 70657356
N-[3-[1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]-3-methoxybenzenesulfonamide (PubChem CID 70657356) has the molecular formula C25H28N4O6S and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[3-[1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]-3-methoxybenzenesulfonamide.
| Compound Name | N-[3-[1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 70657356 |
| Molecular Formula | C25H28N4O6S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[3-[1-hydroxy-2-[2-[(3-methoxy-1H-indazol-6-yl)oxy]ethylamino]ethyl]phenyl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2cccc(C(O)CNCCOc3ccc4c(OC)n[nH]c4c3)c2)c1 |
| InChI | InChI=1S/C25H28N4O6S/c1-33-19-7-4-8-21(14-19)36(31,32)29-18-6-3-5-17(13-18)24(30)16-26-11-12-35-20-9-10-22-23(15-20)27-28-25(22)34-2/h3-10,13-15,24,26,29-30H,11-12,16H2,1-2H3,(H,27,28) |
| InChIKey | BRSLYVXXJXZCCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 134.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|