C21H27N3O5S — CID 123603869
N-[3-[(1S)-1-hydroxy-5-[[3-(methoxymethyl)-2H-indazol-6-yl]oxy]pentyl]phenyl]methanesulfonamide (PubChem CID 123603869) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[3-[(1S)-1-hydroxy-5-[[3-(methoxymethyl)-2H-indazol-6-yl]oxy]pentyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(1S)-1-hydroxy-5-[[3-(methoxymethyl)-2H-indazol-6-yl]oxy]pentyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 123603869 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[3-[(1S)-1-hydroxy-5-[[3-(methoxymethyl)-2H-indazol-6-yl]oxy]pentyl]phenyl]methanesulfonamide |
| SMILES | COCc1[nH]nc2cc(OCCCC[C@H](O)c3cccc(NS(C)(=O)=O)c3)ccc12 |
| InChI | InChI=1S/C21H27N3O5S/c1-28-14-20-18-10-9-17(13-19(18)22-23-20)29-11-4-3-8-21(25)15-6-5-7-16(12-15)24-30(2,26)27/h5-7,9-10,12-13,21,24-25H,3-4,8,11,14H2,1-2H3,(H,22,23)/t21-/m0/s1 |
| InChIKey | BBAXJVOIMNYFNF-NRFANRHFSA-N |
| XLogP | 3.36 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|