C24H30ClN3O4S — CID 70245146
2-chloro-5-[2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methylbenzenesulfonamide (PubChem CID 70245146) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is 2-chloro-5-[2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methylbenzenesulfonamide.
| Compound Name | 2-chloro-5-[2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70245146 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2-chloro-5-[2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(O)CNCCOc2ccc3[nH]c4c(c3c2)CCCCC4)ccc1Cl |
| InChI | InChI=1S/C24H30ClN3O4S/c1-26-33(30,31)24-13-16(7-9-20(24)25)23(29)15-27-11-12-32-17-8-10-22-19(14-17)18-5-3-2-4-6-21(18)28-22/h7-10,13-14,23,26-29H,2-6,11-12,15H2,1H3 |
| InChIKey | CCTXVQUIVWEVGV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|