C24H31N3O5S — CID 20638948
5-[(1R)-2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-2-hydroxy-N-methylbenzenesulfonamide (PubChem CID 20638948) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 5-[(1R)-2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-2-hydroxy-N-methylbenzenesulfonamide.
| Compound Name | 5-[(1R)-2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-2-hydroxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 20638948 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-[(1R)-2-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-2-yloxy)ethylamino]-1-hydroxyethyl]-2-hydroxy-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc([C@@H](O)CNCCOc2ccc3[nH]c4c(c3c2)CCCCC4)ccc1O |
| InChI | InChI=1S/C24H31N3O5S/c1-25-33(30,31)24-13-16(7-10-22(24)28)23(29)15-26-11-12-32-17-8-9-21-19(14-17)18-5-3-2-4-6-20(18)27-21/h7-10,13-14,23,25-29H,2-6,11-12,15H2,1H3/t23-/m0/s1 |
| InChIKey | XXXHDDAEJYPCDE-QHCPKHFHSA-N |
| XLogP | 2.75 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|