C37H52N4O5SSi — CID 22111223
7-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-triethylsilyloxyethyl]amino]ethoxy]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 22111223) has the molecular formula C37H52N4O5SSi and a molecular weight of 693.00 g/mol. Its IUPAC name is 7-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-triethylsilyloxyethyl]amino]ethoxy]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 7-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-triethylsilyloxyethyl]amino]ethoxy]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 22111223 |
| Molecular Formula | C37H52N4O5SSi |
| Molecular Weight | 693.00 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 7-[2-[[2-[3-(dimethylsulfamoylamino)-4-phenylmethoxyphenyl]-2-triethylsilyloxyethyl]amino]ethoxy]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CC[Si](CC)(CC)OC(CNCCOc1ccc2c3c([nH]c2c1)CCCC3)c1ccc(OCc2ccccc2)c(NS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C37H52N4O5SSi/c1-6-48(7-2,8-3)46-37(26-38-22-23-44-30-19-20-32-31-16-12-13-17-33(31)39-34(32)25-30)29-18-21-36(45-27-28-14-10-9-11-15-28)35(24-29)40-47(42,43)41(4)5/h9-11,14-15,18-21,24-25,37-40H,6-8,12-13,16-17,22-23,26-27H2,1-5H3 |
| InChIKey | XVFKWUFABQBKIF-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.00 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|