C23H35IN2O4SSi — CID 18615149
2-(dimethylsulfamoylamino)-4-(2-iodo-1-triethylsilyloxyethyl)-1-phenylmethoxybenzene (PubChem CID 18615149) has the molecular formula C23H35IN2O4SSi and a molecular weight of 590.60 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)-4-(2-iodo-1-triethylsilyloxyethyl)-1-phenylmethoxybenzene.
| Compound Name | 2-(dimethylsulfamoylamino)-4-(2-iodo-1-triethylsilyloxyethyl)-1-phenylmethoxybenzene |
|---|---|
| PubChem CID | 18615149 |
| Molecular Formula | C23H35IN2O4SSi |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 2-(dimethylsulfamoylamino)-4-(2-iodo-1-triethylsilyloxyethyl)-1-phenylmethoxybenzene |
| SMILES | CC[Si](CC)(CC)OC(CI)c1ccc(OCc2ccccc2)c(NS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H35IN2O4SSi/c1-6-32(7-2,8-3)30-23(17-24)20-14-15-22(29-18-19-12-10-9-11-13-19)21(16-20)25-31(27,28)26(4)5/h9-16,23,25H,6-8,17-18H2,1-5H3 |
| InChIKey | PLTHABUTJVTUMV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|