C38H48N2O6SSi — CID 139663762
methyl 4-[(1R)-1-[[(1R)-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]-1-triethylsilyloxyethyl]amino]-2-phenylethyl]benzoate (PubChem CID 139663762) has the molecular formula C38H48N2O6SSi and a molecular weight of 688.96 g/mol. Its IUPAC name is methyl 4-[(1R)-1-[[(1R)-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]-1-triethylsilyloxyethyl]amino]-2-phenylethyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-[[(1R)-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]-1-triethylsilyloxyethyl]amino]-2-phenylethyl]benzoate |
|---|---|
| PubChem CID | 139663762 |
| Molecular Formula | C38H48N2O6SSi |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | methyl 4-[(1R)-1-[[(1R)-2-[3-(methanesulfonamido)-4-phenylmethoxyphenyl]-1-triethylsilyloxyethyl]amino]-2-phenylethyl]benzoate |
| SMILES | CC[Si](CC)(CC)O[C@H](Cc1ccc(OCc2ccccc2)c(NS(C)(=O)=O)c1)N[C@H](Cc1ccccc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C38H48N2O6SSi/c1-6-48(7-2,8-3)46-37(39-34(25-29-15-11-9-12-16-29)32-20-22-33(23-21-32)38(41)44-4)27-31-19-24-36(35(26-31)40-47(5,42)43)45-28-30-17-13-10-14-18-30/h9-24,26,34,37,39-40H,6-8,25,27-28H2,1-5H3/t34-,37-/m1/s1 |
| InChIKey | VNSQFJOPXWRFND-ZLHGTEGGSA-N |
| XLogP | 7.89 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|