C22H31BrINO3SSi — CID 70120038
N-benzyl-N-[2-bromo-5-(2-iodo-1-triethylsilyloxyethyl)phenyl]methanesulfonamide (PubChem CID 70120038) has the molecular formula C22H31BrINO3SSi and a molecular weight of 624.46 g/mol. Its IUPAC name is N-benzyl-N-[2-bromo-5-(2-iodo-1-triethylsilyloxyethyl)phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[2-bromo-5-(2-iodo-1-triethylsilyloxyethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70120038 |
| Molecular Formula | C22H31BrINO3SSi |
| Molecular Weight | 624.46 g/mol |
| Exact Mass | 623.00 |
| IUPAC Name | N-benzyl-N-[2-bromo-5-(2-iodo-1-triethylsilyloxyethyl)phenyl]methanesulfonamide |
| SMILES | CC[Si](CC)(CC)OC(CI)c1ccc(Br)c(N(Cc2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H31BrINO3SSi/c1-5-30(6-2,7-3)28-22(16-24)19-13-14-20(23)21(15-19)25(29(4,26)27)17-18-11-9-8-10-12-18/h8-15,22H,5-7,16-17H2,1-4H3 |
| InChIKey | MZGURIZYSFBHEX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|