C44H50F3N3O4SSi — CID 70034698
N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide (PubChem CID 70034698) has the molecular formula C44H50F3N3O4SSi and a molecular weight of 802.05 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70034698 |
| Molecular Formula | C44H50F3N3O4SSi |
| Molecular Weight | 802.05 g/mol |
| Exact Mass | 801.32 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-triethylsilyloxyethyl]phenyl]methanesulfonamide |
| SMILES | CC[Si](CC)(CC)O[C@@H](CNCCOc1ccc2c3ccc(C(F)(F)F)cc3n(Cc3ccccc3)c2c1)c1cccc(N(Cc2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C44H50F3N3O4SSi/c1-5-56(6-2,7-3)54-43(35-19-14-20-37(27-35)50(55(4,51)52)32-34-17-12-9-13-18-34)30-48-25-26-53-38-22-24-40-39-23-21-36(44(45,46)47)28-41(39)49(42(40)29-38)31-33-15-10-8-11-16-33/h8-24,27-29,43,48H,5-7,25-26,30-32H2,1-4H3/t43-/m0/s1 |
| InChIKey | KTXPFJNPBPTILN-QLKFWGTOSA-N |
| XLogP | 10.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.05 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|