C38H36F3N3O4S — CID 70037140
N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70037140) has the molecular formula C38H36F3N3O4S and a molecular weight of 687.78 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70037140 |
| Molecular Formula | C38H36F3N3O4S |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-[9-benzyl-7-(trifluoromethyl)carbazol-2-yl]oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1cccc([C@@H](O)CNCCOc2ccc3c4ccc(C(F)(F)F)cc4n(Cc4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C38H36F3N3O4S/c1-49(46,47)44(26-28-11-6-3-7-12-28)31-14-8-13-29(21-31)37(45)24-42-19-20-48-32-16-18-34-33-17-15-30(38(39,40)41)22-35(33)43(36(34)23-32)25-27-9-4-2-5-10-27/h2-18,21-23,37,42,45H,19-20,24-26H2,1H3/t37-/m0/s1 |
| InChIKey | WRBYWQDTQLQIQK-QNGWXLTQSA-N |
| XLogP | 7.53 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|