C43H47N3O4S — CID 70033972
N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-cyclohexylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70033972) has the molecular formula C43H47N3O4S and a molecular weight of 701.93 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-cyclohexylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-cyclohexylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70033972 |
| Molecular Formula | C43H47N3O4S |
| Molecular Weight | 701.93 g/mol |
| Exact Mass | 701.33 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-cyclohexylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1cccc([C@@H](O)CNCCOc2ccc3c4ccc(C5CCCCC5)cc4n(Cc4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C43H47N3O4S/c1-51(48,49)46(31-33-14-7-3-8-15-33)37-19-11-18-36(26-37)43(47)29-44-24-25-50-38-21-23-40-39-22-20-35(34-16-9-4-10-17-34)27-41(39)45(42(40)28-38)30-32-12-5-2-6-13-32/h2-3,5-8,11-15,18-23,26-28,34,43-44,47H,4,9-10,16-17,24-25,29-31H2,1H3/t43-/m0/s1 |
| InChIKey | OSICOBRWUJZHPK-QLKFWGTOSA-N |
| XLogP | 8.56 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.93 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|