C37H38N4O4S — CID 70035163
N-[3-[(1R)-2-[2-(7-amino-9-benzylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]-N-benzylmethanesulfonamide (PubChem CID 70035163) has the molecular formula C37H38N4O4S and a molecular weight of 634.80 g/mol. Its IUPAC name is N-[3-[(1R)-2-[2-(7-amino-9-benzylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]-N-benzylmethanesulfonamide.
| Compound Name | N-[3-[(1R)-2-[2-(7-amino-9-benzylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]-N-benzylmethanesulfonamide |
|---|---|
| PubChem CID | 70035163 |
| Molecular Formula | C37H38N4O4S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | N-[3-[(1R)-2-[2-(7-amino-9-benzylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]-N-benzylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1cccc([C@@H](O)CNCCOc2ccc3c4ccc(N)cc4n(Cc4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C37H38N4O4S/c1-46(43,44)41(26-28-11-6-3-7-12-28)31-14-8-13-29(21-31)37(42)24-39-19-20-45-32-16-18-34-33-17-15-30(38)22-35(33)40(36(34)23-32)25-27-9-4-2-5-10-27/h2-18,21-23,37,39,42H,19-20,24-26,38H2,1H3/t37-/m0/s1 |
| InChIKey | NTQNTDVKYRMDCY-QNGWXLTQSA-N |
| XLogP | 6.09 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|