C39H41N3O5S — CID 70037503
N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-ethoxycarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70037503) has the molecular formula C39H41N3O5S and a molecular weight of 663.84 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-ethoxycarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-ethoxycarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70037503 |
| Molecular Formula | C39H41N3O5S |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-ethoxycarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CCOc1ccc2c3ccc(OCCNC[C@H](O)c4cccc(N(Cc5ccccc5)S(C)(=O)=O)c4)cc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C39H41N3O5S/c1-3-46-33-17-19-35-36-20-18-34(25-38(36)41(37(35)24-33)27-29-11-6-4-7-12-29)47-22-21-40-26-39(43)31-15-10-16-32(23-31)42(48(2,44)45)28-30-13-8-5-9-14-30/h4-20,23-25,39-40,43H,3,21-22,26-28H2,1-2H3/t39-/m0/s1 |
| InChIKey | GHGKHENHABEPCC-KDXMTYKHSA-N |
| XLogP | 6.91 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|