C20H28BrClN2O3S — CID 18341542
N-benzyl-N-[3-[(1R)-2-[2-bromoethyl(ethyl)amino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride (PubChem CID 18341542) has the molecular formula C20H28BrClN2O3S and a molecular weight of 491.88 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-bromoethyl(ethyl)amino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-bromoethyl(ethyl)amino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 18341542 |
| Molecular Formula | C20H28BrClN2O3S |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-bromoethyl(ethyl)amino]-1-hydroxyethyl]phenyl]methanesulfonamide;hydrochloride |
| SMILES | CCN(CCBr)C[C@H](O)c1cccc(N(Cc2ccccc2)S(C)(=O)=O)c1.Cl |
| InChI | InChI=1S/C20H27BrN2O3S.ClH/c1-3-22(13-12-21)16-20(24)18-10-7-11-19(14-18)23(27(2,25)26)15-17-8-5-4-6-9-17;/h4-11,14,20,24H,3,12-13,15-16H2,1-2H3;1H/t20-;/m0./s1 |
| InChIKey | OBBHWENFORWIBM-BDQAORGHSA-N |
| XLogP | 3.82 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|