C31H30BrN3O4S2 — CID 162245703
N-benzyl-N-(3-isocyanophenyl)methanesulfonamide;bromomethylbenzene;1-isocyano-3-(methylsulfonylmethyl)benzene (PubChem CID 162245703) has the molecular formula C31H30BrN3O4S2 and a molecular weight of 652.64 g/mol. Its IUPAC name is N-benzyl-N-(3-isocyanophenyl)methanesulfonamide;bromomethylbenzene;1-isocyano-3-(methylsulfonylmethyl)benzene.
| Compound Name | N-benzyl-N-(3-isocyanophenyl)methanesulfonamide;bromomethylbenzene;1-isocyano-3-(methylsulfonylmethyl)benzene |
|---|---|
| PubChem CID | 162245703 |
| Molecular Formula | C31H30BrN3O4S2 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | N-benzyl-N-(3-isocyanophenyl)methanesulfonamide;bromomethylbenzene;1-isocyano-3-(methylsulfonylmethyl)benzene |
| SMILES | BrCc1ccccc1.[C-]#[N+]c1cccc(CS(C)(=O)=O)c1.[C-]#[N+]c1cccc(N(Cc2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H14N2O2S.C9H9NO2S.C7H7Br/c1-16-14-9-6-10-15(11-14)17(20(2,18)19)12-13-7-4-3-5-8-13;1-10-9-5-3-4-8(6-9)7-13(2,11)12;8-6-7-4-2-1-3-5-7/h3-11H,12H2,2H3;3-6H,7H2,2H3;1-5H,6H2 |
| InChIKey | ZXHNKBHUJLANLF-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 80.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|