C38H39N3O6S2 — CID 70034079
N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-methylsulfonylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide (PubChem CID 70034079) has the molecular formula C38H39N3O6S2 and a molecular weight of 697.88 g/mol. Its IUPAC name is N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-methylsulfonylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-methylsulfonylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70034079 |
| Molecular Formula | C38H39N3O6S2 |
| Molecular Weight | 697.88 g/mol |
| Exact Mass | 697.23 |
| IUPAC Name | N-benzyl-N-[3-[(1R)-2-[2-(9-benzyl-7-methylsulfonylcarbazol-2-yl)oxyethylamino]-1-hydroxyethyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)c1ccc2c3ccc(OCCNC[C@H](O)c4cccc(N(Cc5ccccc5)S(C)(=O)=O)c4)cc3n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C38H39N3O6S2/c1-48(43,44)33-17-19-35-34-18-16-32(23-36(34)40(37(35)24-33)26-28-10-5-3-6-11-28)47-21-20-39-25-38(42)30-14-9-15-31(22-30)41(49(2,45)46)27-29-12-7-4-8-13-29/h3-19,22-24,38-39,42H,20-21,25-27H2,1-2H3/t38-/m0/s1 |
| InChIKey | LYAHEGUNZMEQIZ-LHEWISCISA-N |
| XLogP | 5.91 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|