C25H37FN2O6SSi — CID 66615175
[5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-methylsulfonylcarbamic acid (PubChem CID 66615175) has the molecular formula C25H37FN2O6SSi and a molecular weight of 540.73 g/mol. Its IUPAC name is [5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-methylsulfonylcarbamic acid.
| Compound Name | [5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-methylsulfonylcarbamic acid |
|---|---|
| PubChem CID | 66615175 |
| Molecular Formula | C25H37FN2O6SSi |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-methylsulfonylcarbamic acid |
| SMILES | CC[Si](CC)(CC)OC(CN(CCO)Cc1ccccc1)c1ccc(F)c(N(C(=O)O)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H37FN2O6SSi/c1-5-36(6-2,7-3)34-24(19-27(15-16-29)18-20-11-9-8-10-12-20)21-13-14-22(26)23(17-21)28(25(30)31)35(4,32)33/h8-14,17,24,29H,5-7,15-16,18-19H2,1-4H3,(H,30,31) |
| InChIKey | QYKMYOOWRHMSLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|