C29H45FN2O6SSi — CID 123195940
[[5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-tert-butylcarbamoyl] methanesulfonate (PubChem CID 123195940) has the molecular formula C29H45FN2O6SSi and a molecular weight of 596.84 g/mol. Its IUPAC name is [[5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-tert-butylcarbamoyl] methanesulfonate.
| Compound Name | [[5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-tert-butylcarbamoyl] methanesulfonate |
|---|---|
| PubChem CID | 123195940 |
| Molecular Formula | C29H45FN2O6SSi |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | [[5-[2-[benzyl(2-hydroxyethyl)amino]-1-triethylsilyloxyethyl]-2-fluorophenyl]-tert-butylcarbamoyl] methanesulfonate |
| SMILES | CC[Si](CC)(CC)OC(CN(CCO)Cc1ccccc1)c1ccc(F)c(N(C(=O)OS(C)(=O)=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H45FN2O6SSi/c1-8-40(9-2,10-3)38-27(22-31(18-19-33)21-23-14-12-11-13-15-23)24-16-17-25(30)26(20-24)32(29(4,5)6)28(34)37-39(7,35)36/h11-17,20,27,33H,8-10,18-19,21-22H2,1-7H3 |
| InChIKey | BCYRRKQJEGDACZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|