C35H45N3O5Si — CID 70245175
1-(3-nitro-4-phenylmethoxyphenyl)-4-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)-1-triethylsilyloxybutan-2-amine (PubChem CID 70245175) has the molecular formula C35H45N3O5Si and a molecular weight of 615.85 g/mol. Its IUPAC name is 1-(3-nitro-4-phenylmethoxyphenyl)-4-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)-1-triethylsilyloxybutan-2-amine.
| Compound Name | 1-(3-nitro-4-phenylmethoxyphenyl)-4-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)-1-triethylsilyloxybutan-2-amine |
|---|---|
| PubChem CID | 70245175 |
| Molecular Formula | C35H45N3O5Si |
| Molecular Weight | 615.85 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | 1-(3-nitro-4-phenylmethoxyphenyl)-4-(6,7,8,9-tetrahydro-5H-carbazol-2-yloxy)-1-triethylsilyloxybutan-2-amine |
| SMILES | CC[Si](CC)(CC)OC(c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1)C(N)CCOc1ccc2c3c([nH]c2c1)CCCC3 |
| InChI | InChI=1S/C35H45N3O5Si/c1-4-44(5-2,6-3)43-35(26-16-19-34(33(22-26)38(39)40)42-24-25-12-8-7-9-13-25)30(36)20-21-41-27-17-18-29-28-14-10-11-15-31(28)37-32(29)23-27/h7-9,12-13,16-19,22-23,30,35,37H,4-6,10-11,14-15,20-21,24,36H2,1-3H3 |
| InChIKey | GFXXCOVCCIHFCK-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.85 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|