C36H30N2O6 — CID 70034704
2-[(3-dibenzofuran-3-yloxy-1-phenylpropyl)amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone (PubChem CID 70034704) has the molecular formula C36H30N2O6 and a molecular weight of 586.64 g/mol. Its IUPAC name is 2-[(3-dibenzofuran-3-yloxy-1-phenylpropyl)amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone.
| Compound Name | 2-[(3-dibenzofuran-3-yloxy-1-phenylpropyl)amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 70034704 |
| Molecular Formula | C36H30N2O6 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 2-[(3-dibenzofuran-3-yloxy-1-phenylpropyl)amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
| SMILES | O=C(CNC(CCOc1ccc2c(c1)oc1ccccc12)c1ccccc1)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H30N2O6/c39-33(27-15-18-35(32(21-27)38(40)41)43-24-25-9-3-1-4-10-25)23-37-31(26-11-5-2-6-12-26)19-20-42-28-16-17-30-29-13-7-8-14-34(29)44-36(30)22-28/h1-18,21-22,31,37H,19-20,23-24H2 |
| InChIKey | XIUTVTLHOHYSEN-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|