C36H30N2O5 — CID 70033210
N-[2-(3-amino-4-phenylmethoxyphenyl)-2-oxoethyl]-2-(2-dibenzofuran-3-yloxyethyl)benzamide (PubChem CID 70033210) has the molecular formula C36H30N2O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is N-[2-(3-amino-4-phenylmethoxyphenyl)-2-oxoethyl]-2-(2-dibenzofuran-3-yloxyethyl)benzamide.
| Compound Name | N-[2-(3-amino-4-phenylmethoxyphenyl)-2-oxoethyl]-2-(2-dibenzofuran-3-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 70033210 |
| Molecular Formula | C36H30N2O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | N-[2-(3-amino-4-phenylmethoxyphenyl)-2-oxoethyl]-2-(2-dibenzofuran-3-yloxyethyl)benzamide |
| SMILES | Nc1cc(C(=O)CNC(=O)c2ccccc2CCOc2ccc3c(c2)oc2ccccc23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H30N2O5/c37-31-20-26(14-17-34(31)42-23-24-8-2-1-3-9-24)32(39)22-38-36(40)28-11-5-4-10-25(28)18-19-41-27-15-16-30-29-12-6-7-13-33(29)43-35(30)21-27/h1-17,20-21H,18-19,22-23,37H2,(H,38,40) |
| InChIKey | DFXOIYMGQCRUQA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|