C36H28N2O7 — CID 70035151
2-(2-dibenzofuran-3-yloxyethyl)-N-[2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoethyl]benzamide (PubChem CID 70035151) has the molecular formula C36H28N2O7 and a molecular weight of 600.63 g/mol. Its IUPAC name is 2-(2-dibenzofuran-3-yloxyethyl)-N-[2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoethyl]benzamide.
| Compound Name | 2-(2-dibenzofuran-3-yloxyethyl)-N-[2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 70035151 |
| Molecular Formula | C36H28N2O7 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | 2-(2-dibenzofuran-3-yloxyethyl)-N-[2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1CCOc1ccc2c(c1)oc1ccccc12)c1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H28N2O7/c39-32(26-14-17-34(31(20-26)38(41)42)44-23-24-8-2-1-3-9-24)22-37-36(40)28-11-5-4-10-25(28)18-19-43-27-15-16-30-29-12-6-7-13-33(29)45-35(30)21-27/h1-17,20-21H,18-19,22-23H2,(H,37,40) |
| InChIKey | HAXRDQZJKXIHLC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|