C32H32N2O4 — CID 57122103
2-[[3-(4-methylphenyl)-4-phenylbutan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone (PubChem CID 57122103) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-[[3-(4-methylphenyl)-4-phenylbutan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone.
| Compound Name | 2-[[3-(4-methylphenyl)-4-phenylbutan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 57122103 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[[3-(4-methylphenyl)-4-phenylbutan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
| SMILES | Cc1ccc(C(Cc2ccccc2)C(C)NCC(=O)c2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H32N2O4/c1-23-13-15-27(16-14-23)29(19-25-9-5-3-6-10-25)24(2)33-21-31(35)28-17-18-32(30(20-28)34(36)37)38-22-26-11-7-4-8-12-26/h3-18,20,24,29,33H,19,21-22H2,1-2H3 |
| InChIKey | REKAKTOFURIFDQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|