C29H25ClN2O6 — CID 70032104
N-[2-(4-chloro-3-nitrophenyl)-2-oxoethyl]-2-[2-(6,7,8,9-tetrahydrodibenzofuran-4-yloxy)ethyl]benzamide (PubChem CID 70032104) has the molecular formula C29H25ClN2O6 and a molecular weight of 532.98 g/mol. Its IUPAC name is N-[2-(4-chloro-3-nitrophenyl)-2-oxoethyl]-2-[2-(6,7,8,9-tetrahydrodibenzofuran-4-yloxy)ethyl]benzamide.
| Compound Name | N-[2-(4-chloro-3-nitrophenyl)-2-oxoethyl]-2-[2-(6,7,8,9-tetrahydrodibenzofuran-4-yloxy)ethyl]benzamide |
|---|---|
| PubChem CID | 70032104 |
| Molecular Formula | C29H25ClN2O6 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[2-(4-chloro-3-nitrophenyl)-2-oxoethyl]-2-[2-(6,7,8,9-tetrahydrodibenzofuran-4-yloxy)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1CCOc1cccc2c3c(oc12)CCCC3)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H25ClN2O6/c30-23-13-12-19(16-24(23)32(35)36)25(33)17-31-29(34)20-7-2-1-6-18(20)14-15-37-27-11-5-9-22-21-8-3-4-10-26(21)38-28(22)27/h1-2,5-7,9,11-13,16H,3-4,8,10,14-15,17H2,(H,31,34) |
| InChIKey | LQPXCEASESKCPP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|