C20H20ClN3O7 — CID 55425893
[1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 55425893) has the molecular formula C20H20ClN3O7 and a molecular weight of 449.85 g/mol. Its IUPAC name is [1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55425893 |
| Molecular Formula | C20H20ClN3O7 |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [1-[(2-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | COc1ccccc1CNC(=O)C(C)OC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20ClN3O7/c1-12(19(26)22-10-14-5-3-4-6-17(14)30-2)31-18(25)11-23-20(27)13-7-8-15(21)16(9-13)24(28)29/h3-9,12H,10-11H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | YTYDDEWKFGNOQB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|