C22H18ClN3O6 — CID 55320639
[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 55320639) has the molecular formula C22H18ClN3O6 and a molecular weight of 455.85 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55320639 |
| Molecular Formula | C22H18ClN3O6 |
| Molecular Weight | 455.85 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | CC(OC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H18ClN3O6/c1-13(21(28)25-17-8-6-14-4-2-3-5-15(14)10-17)32-20(27)12-24-22(29)16-7-9-18(23)19(11-16)26(30)31/h2-11,13H,12H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | FRNQCVRTLQIUMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|