C19H24ClN3O6 — CID 98869594
[(2S)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 98869594) has the molecular formula C19H24ClN3O6 and a molecular weight of 425.87 g/mol. Its IUPAC name is [(2S)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [(2S)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 98869594 |
| Molecular Formula | C19H24ClN3O6 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [(2S)-1-[[(1S,2S)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | C[C@H](OC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)N[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C19H24ClN3O6/c1-11-5-3-4-6-15(11)22-18(25)12(2)29-17(24)10-21-19(26)13-7-8-14(20)16(9-13)23(27)28/h7-9,11-12,15H,3-6,10H2,1-2H3,(H,21,26)(H,22,25)/t11-,12-,15-/m0/s1 |
| InChIKey | IYXQKNVLLSQGHI-HUBLWGQQSA-N |
| XLogP | 2.60 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|