C13H13ClN4O7 — CID 46791490
[1-(carbamoylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate (PubChem CID 46791490) has the molecular formula C13H13ClN4O7 and a molecular weight of 372.72 g/mol. Its IUPAC name is [1-(carbamoylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate.
| Compound Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46791490 |
| Molecular Formula | C13H13ClN4O7 |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | [1-(carbamoylamino)-1-oxopropan-2-yl] 2-[(4-chloro-3-nitrobenzoyl)amino]acetate |
| SMILES | CC(OC(=O)CNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H13ClN4O7/c1-6(11(20)17-13(15)22)25-10(19)5-16-12(21)7-2-3-8(14)9(4-7)18(23)24/h2-4,6H,5H2,1H3,(H,16,21)(H3,15,17,20,22) |
| InChIKey | XJAQXTIVTRAUEH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|