C29H24BrN3O4 — CID 70033407
1-(4-bromo-3-nitrophenyl)-2-[[3-(9H-carbazol-2-yloxy)-1-phenylpropyl]amino]ethanone (PubChem CID 70033407) has the molecular formula C29H24BrN3O4 and a molecular weight of 558.43 g/mol. Its IUPAC name is 1-(4-bromo-3-nitrophenyl)-2-[[3-(9H-carbazol-2-yloxy)-1-phenylpropyl]amino]ethanone.
| Compound Name | 1-(4-bromo-3-nitrophenyl)-2-[[3-(9H-carbazol-2-yloxy)-1-phenylpropyl]amino]ethanone |
|---|---|
| PubChem CID | 70033407 |
| Molecular Formula | C29H24BrN3O4 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 1-(4-bromo-3-nitrophenyl)-2-[[3-(9H-carbazol-2-yloxy)-1-phenylpropyl]amino]ethanone |
| SMILES | O=C(CNC(CCOc1ccc2c(c1)[nH]c1ccccc12)c1ccccc1)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H24BrN3O4/c30-24-13-10-20(16-28(24)33(35)36)29(34)18-31-25(19-6-2-1-3-7-19)14-15-37-21-11-12-23-22-8-4-5-9-26(22)32-27(23)17-21/h1-13,16-17,25,31-32H,14-15,18H2 |
| InChIKey | WRDYLOYOYOOFSQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|