C33H33NO5 — CID 23031168
4-[3-ethyl-2-(2-phenylethoxy)-4-phenylmethoxyphenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene (PubChem CID 23031168) has the molecular formula C33H33NO5 and a molecular weight of 523.63 g/mol. Its IUPAC name is 4-[3-ethyl-2-(2-phenylethoxy)-4-phenylmethoxyphenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene.
| Compound Name | 4-[3-ethyl-2-(2-phenylethoxy)-4-phenylmethoxyphenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 23031168 |
| Molecular Formula | C33H33NO5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-[3-ethyl-2-(2-phenylethoxy)-4-phenylmethoxyphenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene |
| SMILES | CCc1c(OCc2ccccc2)ccc(Oc2c(C)cc([N+](=O)[O-])c3c2CCC3)c1OCCc1ccccc1 |
| InChI | InChI=1S/C33H33NO5/c1-3-26-30(38-22-25-13-8-5-9-14-25)17-18-31(33(26)37-20-19-24-11-6-4-7-12-24)39-32-23(2)21-29(34(35)36)27-15-10-16-28(27)32/h4-9,11-14,17-18,21H,3,10,15-16,19-20,22H2,1-2H3 |
| InChIKey | TZBWVLVQMCYOAU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|