C20H18F3NO8S — CID 23031247
[2-acetyl-3-methoxy-4-[(5-methyl-7-nitro-2,3-dihydro-1H-inden-4-yl)oxy]phenyl] trifluoromethanesulfonate (PubChem CID 23031247) has the molecular formula C20H18F3NO8S and a molecular weight of 489.42 g/mol. Its IUPAC name is [2-acetyl-3-methoxy-4-[(5-methyl-7-nitro-2,3-dihydro-1H-inden-4-yl)oxy]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-acetyl-3-methoxy-4-[(5-methyl-7-nitro-2,3-dihydro-1H-inden-4-yl)oxy]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23031247 |
| Molecular Formula | C20H18F3NO8S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [2-acetyl-3-methoxy-4-[(5-methyl-7-nitro-2,3-dihydro-1H-inden-4-yl)oxy]phenyl] trifluoromethanesulfonate |
| SMILES | COc1c(Oc2c(C)cc([N+](=O)[O-])c3c2CCC3)ccc(OS(=O)(=O)C(F)(F)F)c1C(C)=O |
| InChI | InChI=1S/C20H18F3NO8S/c1-10-9-14(24(26)27)12-5-4-6-13(12)18(10)31-16-8-7-15(17(11(2)25)19(16)30-3)32-33(28,29)20(21,22)23/h7-9H,4-6H2,1-3H3 |
| InChIKey | OSVUPYAYMMTRAJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|