C26H25NO5 — CID 23031101
4-[4-methoxy-3-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene (PubChem CID 23031101) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-[4-methoxy-3-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene.
| Compound Name | 4-[4-methoxy-3-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 23031101 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-[4-methoxy-3-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-5-methyl-7-nitro-2,3-dihydro-1H-indene |
| SMILES | COc1cccc(/C=C/c2cc(Oc3c(C)cc([N+](=O)[O-])c4c3CCC4)ccc2OC)c1 |
| InChI | InChI=1S/C26H25NO5/c1-17-14-24(27(28)29)22-8-5-9-23(22)26(17)32-21-12-13-25(31-3)19(16-21)11-10-18-6-4-7-20(15-18)30-2/h4,6-7,10-16H,5,8-9H2,1-3H3/b11-10+ |
| InChIKey | MGMWXUFFSHKDEO-ZHACJKMWSA-N |
| XLogP | 6.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|